About 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene
10-thiatricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 166732853) has the molecular formula C9H10S
and a molecular weight of 150.25 g/mol. Its IUPAC name is 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene.
Molecular Properties
| Compound Name | 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene |
| PubChem CID | 166732853 |
| Molecular Formula | C9H10S |
| Molecular Weight | 150.25 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(S3)C2C1 |
| InChI | InChI=1S/C9H10S/c1-2-6-7(3-1)9-5-4-8(6)10-9/h1-2,4-9H,3H2 |
| InChIKey | ZBABBYKYRAYBKF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene?
The IUPAC name of 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene (CID 166732853) is 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene.
What is the SMILES notation for 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene?
The canonical SMILES for 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene is C1=CC2C3C=CC(S3)C2C1.
What is the InChIKey of 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene?
The InChIKey is ZBABBYKYRAYBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S/c1-2-6-7(3-1)9-5-4-8(6)10-9/h1-2,4-9H,3H2.
What are the key properties of 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene?
10-thiatricyclo[5.2.1.02,6]deca-3,8-diene has a molecular weight of 150.25 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-thiatricyclo[5.2.1.02,6]deca-3,8-diene is sourced from PubChem (CID 166732853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).