C37H45N3+2 — CID 166732902
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,4,5-tetrakis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2,4-triazole-1,4-diium (PubChem CID 166732902) has the molecular formula C37H45N3+2 and a molecular weight of 531.79 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,4,5-tetrakis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2,4-triazole-1,4-diium.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,4,5-tetrakis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2,4-triazole-1,4-diium |
|---|---|
| PubChem CID | 166732902 |
| Molecular Formula | C37H45N3+2 |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,4,5-tetrakis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2,4-triazole-1,4-diium |
| SMILES | C=C/C=C\C(=C/C)c1n(C(/C=C\C)=C/C=C)[n+](C(/C=C\C)=C/C=C)c(C(/C=C\C)=C/C=C)[n+]1C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C37H45N3/c1-11-21-30-31(20-10)36-38(33(24-14-4)25-15-5)37(32(22-12-2)23-13-3)40(35(28-18-8)29-19-9)39(36)34(26-16-6)27-17-7/h11-30H,1-2,4,6,8H2,3,5,7,9-10H3/q+2/b23-13-,25-15-,27-17-,29-19-,30-21-,31-20+,32-22+,33-24+,34-26+,35-28+ |
| InChIKey | LKFKPSFQXQJJGZ-AOAXFQFMSA-N |
| XLogP | 9.16 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|