C38H45N3+2 — CID 166732903
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,5-tris[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazole-1,4-diium (PubChem CID 166732903) has the molecular formula C38H45N3+2 and a molecular weight of 543.80 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,5-tris[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazole-1,4-diium.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,5-tris[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazole-1,4-diium |
|---|---|
| PubChem CID | 166732903 |
| Molecular Formula | C38H45N3+2 |
| Molecular Weight | 543.80 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,5-tris[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazole-1,4-diium |
| SMILES | C=C/C=C\C(=C/C)c1n(C(/C=C\C)=C/C=C)[n+](C(/C=C\C)=C/C=C)c(C(/C=C\C)=C/C=C)[n+]1C(/C=C\C=C)=C/C=C |
| InChI | InChI=1S/C38H45N3/c1-11-21-30-32(20-10)37-39(34(25-15-5)31-22-12-2)38(33(23-13-3)24-14-4)41(36(28-18-8)29-19-9)40(37)35(26-16-6)27-17-7/h11-31H,1-3,5-6,8H2,4,7,9-10H3/q+2/b24-14-,27-17-,29-19-,30-21-,31-22-,32-20+,33-23+,34-25+,35-26+,36-28+ |
| InChIKey | GLUOULZCUCGJIS-PZVUCFLTSA-N |
| XLogP | 9.33 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.80 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|