C37H70N2O — CID 166733582
N'-(2-butyloctyl)-N,N'-dimethyl-N-[[4-(tridecan-6-yloxymethyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 166733582) has the molecular formula C37H70N2O and a molecular weight of 558.98 g/mol. Its IUPAC name is N'-(2-butyloctyl)-N,N'-dimethyl-N-[[4-(tridecan-6-yloxymethyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-(2-butyloctyl)-N,N'-dimethyl-N-[[4-(tridecan-6-yloxymethyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 166733582 |
| Molecular Formula | C37H70N2O |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.55 |
| IUPAC Name | N'-(2-butyloctyl)-N,N'-dimethyl-N-[[4-(tridecan-6-yloxymethyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CCCCCCCC(CCCCC)OCc1ccc(CN(C)CCN(C)CC(CCCC)CCCCCC)cc1 |
| InChI | InChI=1S/C37H70N2O/c1-7-11-15-17-20-24-37(23-18-13-9-3)40-33-36-27-25-35(26-28-36)32-39(6)30-29-38(5)31-34(21-14-10-4)22-19-16-12-8-2/h25-28,34,37H,7-24,29-33H2,1-6H3 |
| InChIKey | WYTQDRTXHHPEJD-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|