C11H19NO2 — CID 166733770
(4aR,5R)-5-ethyl-1,1-dimethyl-4,4a,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazin-7-one (PubChem CID 166733770) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (4aR,5R)-5-ethyl-1,1-dimethyl-4,4a,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazin-7-one.
| Compound Name | (4aR,5R)-5-ethyl-1,1-dimethyl-4,4a,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazin-7-one |
|---|---|
| PubChem CID | 166733770 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (4aR,5R)-5-ethyl-1,1-dimethyl-4,4a,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazin-7-one |
| SMILES | CC[C@@H]1CC(=O)N2[C@@H]1CCOC2(C)C |
| InChI | InChI=1S/C11H19NO2/c1-4-8-7-10(13)12-9(8)5-6-14-11(12,2)3/h8-9H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | NWYVPDQNGWINCY-RKDXNWHRSA-N |
| XLogP | 1.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |