About 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal
4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal (PubChem CID 166734043) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal.
Molecular Properties
| Compound Name | 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal |
| PubChem CID | 166734043 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal |
| SMILES | C=C(C=O)C(C)C(CC)CC(C)C=C(C)C |
| InChI | InChI=1S/C15H26O/c1-7-15(14(6)13(5)10-16)9-12(4)8-11(2)3/h8,10,12,14-15H,5,7,9H2,1-4,6H3 |
| InChIKey | GSRSCTKVAGHUNB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal?
The IUPAC name of 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal (CID 166734043) is 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal.
What is the SMILES notation for 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal?
The canonical SMILES for 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal is C=C(C=O)C(C)C(CC)CC(C)C=C(C)C.
What is the InChIKey of 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal?
The InChIKey is GSRSCTKVAGHUNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O/c1-7-15(14(6)13(5)10-16)9-12(4)8-11(2)3/h8,10,12,14-15H,5,7,9H2,1-4,6H3.
What are the key properties of 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal?
4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal has a molecular weight of 222.37 g/mol, XLogP of 4.40, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3,6,8-trimethyl-2-methylidenenon-7-enal is sourced from PubChem (CID 166734043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).