C12H13N3O3S — CID 166734072
3-(1,3-benzodioxol-5-yl)-N-methylsulfanyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 166734072) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-methylsulfanyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-methylsulfanyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 166734072 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-methylsulfanyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CSNC(=O)N1N=CCC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13N3O3S/c1-19-14-12(16)15-9(4-5-13-15)8-2-3-10-11(6-8)18-7-17-10/h2-3,5-6,9H,4,7H2,1H3,(H,14,16) |
| InChIKey | ZBAZLYSVLNHEBC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|