C28H41N5O2 — CID 166734309
4-cyano-N-[6-(4,4-dimethylcyclohexen-1-yl)-2-(2-ethyl-2,6,6-trimethyloxan-4-yl)-1,2-dihydropyridin-5-yl]-2,3-dihydro-1H-imidazole-2-carboxamide (PubChem CID 166734309) has the molecular formula C28H41N5O2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 4-cyano-N-[6-(4,4-dimethylcyclohexen-1-yl)-2-(2-ethyl-2,6,6-trimethyloxan-4-yl)-1,2-dihydropyridin-5-yl]-2,3-dihydro-1H-imidazole-2-carboxamide.
| Compound Name | 4-cyano-N-[6-(4,4-dimethylcyclohexen-1-yl)-2-(2-ethyl-2,6,6-trimethyloxan-4-yl)-1,2-dihydropyridin-5-yl]-2,3-dihydro-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 166734309 |
| Molecular Formula | C28H41N5O2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | 4-cyano-N-[6-(4,4-dimethylcyclohexen-1-yl)-2-(2-ethyl-2,6,6-trimethyloxan-4-yl)-1,2-dihydropyridin-5-yl]-2,3-dihydro-1H-imidazole-2-carboxamide |
| SMILES | CCC1(C)CC(C2C=CC(NC(=O)C3NC=C(C#N)N3)=C(C3=CCC(C)(C)CC3)N2)CC(C)(C)O1 |
| InChI | InChI=1S/C28H41N5O2/c1-7-28(6)15-19(14-27(4,5)35-28)21-8-9-22(33-25(34)24-30-17-20(16-29)31-24)23(32-21)18-10-12-26(2,3)13-11-18/h8-10,17,19,21,24,30-32H,7,11-15H2,1-6H3,(H,33,34) |
| InChIKey | GFQALEDLQKLCGT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |