C28H35IN4O5 — CID 166734385
5-cyano-N-[4-[(1S,3R,6S)-1,3-dihydroxy-3,6-bis(hydroxymethyl)-6-iodocycloheptyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide (PubChem CID 166734385) has the molecular formula C28H35IN4O5 and a molecular weight of 634.52 g/mol. Its IUPAC name is 5-cyano-N-[4-[(1S,3R,6S)-1,3-dihydroxy-3,6-bis(hydroxymethyl)-6-iodocycloheptyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[4-[(1S,3R,6S)-1,3-dihydroxy-3,6-bis(hydroxymethyl)-6-iodocycloheptyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 166734385 |
| Molecular Formula | C28H35IN4O5 |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | 5-cyano-N-[4-[(1S,3R,6S)-1,3-dihydroxy-3,6-bis(hydroxymethyl)-6-iodocycloheptyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2cc([C@]3(O)C[C@@](O)(CO)CC[C@@](I)(CO)C3)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1 |
| InChI | InChI=1S/C28H35IN4O5/c1-25(2)7-5-18(6-8-25)21-11-19(3-4-22(21)33-24(36)23-31-13-20(12-30)32-23)28(38)14-26(29,16-34)9-10-27(37,15-28)17-35/h3-5,11,13,34-35,37-38H,6-10,14-17H2,1-2H3,(H,31,32)(H,33,36)/t26-,27+,28+/m0/s1 |
| InChIKey | KQUVXTZQXIWUPN-UPRLRBBYSA-N |
| XLogP | 3.78 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|