C24H29FN2O3 — CID 16673462
2-[4-[[[1-(2-fluorophenyl)cyclopentyl]amino]methyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 16673462) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[4-[[[1-(2-fluorophenyl)cyclopentyl]amino]methyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[[[1-(2-fluorophenyl)cyclopentyl]amino]methyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 16673462 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-[4-[[[1-(2-fluorophenyl)cyclopentyl]amino]methyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | O=C(COc1ccc(CNC2(c3ccccc3F)CCCC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C24H29FN2O3/c25-22-6-2-1-5-21(22)24(11-3-4-12-24)26-17-19-7-9-20(10-8-19)30-18-23(28)27-13-15-29-16-14-27/h1-2,5-10,26H,3-4,11-18H2 |
| InChIKey | KOEHXULNMIODOH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |