About (Z)-7,7-difluoro-4-methoxyhept-2-ene
(Z)-7,7-difluoro-4-methoxyhept-2-ene (PubChem CID 166734987) has the molecular formula C8H14F2O
and a molecular weight of 164.19 g/mol. Its IUPAC name is (Z)-7,7-difluoro-4-methoxyhept-2-ene.
Molecular Properties
| Compound Name | (Z)-7,7-difluoro-4-methoxyhept-2-ene |
| PubChem CID | 166734987 |
| Molecular Formula | C8H14F2O |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (Z)-7,7-difluoro-4-methoxyhept-2-ene |
| SMILES | C/C=C\C(CCC(F)F)OC |
| InChI | InChI=1S/C8H14F2O/c1-3-4-7(11-2)5-6-8(9)10/h3-4,7-8H,5-6H2,1-2H3/b4-3- |
| InChIKey | VAJCMIRZALRVGR-ARJAWSKDSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7,7-difluoro-4-methoxyhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7,7-difluoro-4-methoxyhept-2-ene?
The IUPAC name of (Z)-7,7-difluoro-4-methoxyhept-2-ene (CID 166734987) is (Z)-7,7-difluoro-4-methoxyhept-2-ene.
What is the SMILES notation for (Z)-7,7-difluoro-4-methoxyhept-2-ene?
The canonical SMILES for (Z)-7,7-difluoro-4-methoxyhept-2-ene is C/C=C\C(CCC(F)F)OC.
What is the InChIKey of (Z)-7,7-difluoro-4-methoxyhept-2-ene?
The InChIKey is VAJCMIRZALRVGR-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H14F2O/c1-3-4-7(11-2)5-6-8(9)10/h3-4,7-8H,5-6H2,1-2H3/b4-3-.
What are the key properties of (Z)-7,7-difluoro-4-methoxyhept-2-ene?
(Z)-7,7-difluoro-4-methoxyhept-2-ene has a molecular weight of 164.19 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7,7-difluoro-4-methoxyhept-2-ene is sourced from PubChem (CID 166734987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).