C21H33F3N2 — CID 166735034
N'-[(3Z,5Z,7Z)-3-(2,4-dimethylpentylidene)-5-ethenyl-10,10,10-trifluorodeca-5,7-dien-2-yl]ethanimidamide (PubChem CID 166735034) has the molecular formula C21H33F3N2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N'-[(3Z,5Z,7Z)-3-(2,4-dimethylpentylidene)-5-ethenyl-10,10,10-trifluorodeca-5,7-dien-2-yl]ethanimidamide.
| Compound Name | N'-[(3Z,5Z,7Z)-3-(2,4-dimethylpentylidene)-5-ethenyl-10,10,10-trifluorodeca-5,7-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 166735034 |
| Molecular Formula | C21H33F3N2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N'-[(3Z,5Z,7Z)-3-(2,4-dimethylpentylidene)-5-ethenyl-10,10,10-trifluorodeca-5,7-dien-2-yl]ethanimidamide |
| SMILES | C=C/C(=C\C=C/CC(F)(F)F)C/C(=C/C(C)CC(C)C)C(C)/N=C(\C)N |
| InChI | InChI=1S/C21H33F3N2/c1-7-19(10-8-9-11-21(22,23)24)14-20(17(5)26-18(6)25)13-16(4)12-15(2)3/h7-10,13,15-17H,1,11-12,14H2,2-6H3,(H2,25,26)/b9-8-,19-10+,20-13- |
| InChIKey | KMDQIKHNJMEYCZ-ULVFRLBGSA-N |
| XLogP | 6.37 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|