About 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline
5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline (PubChem CID 166735767) has the molecular formula C19H18N4S
and a molecular weight of 334.45 g/mol. Its IUPAC name is 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline.
Molecular Properties
| Compound Name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline |
| PubChem CID | 166735767 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline |
| SMILES | [H]/N=C(\C=C\c1ccccn1)c1ccc(-c2sc(C)nc2C)cc1N |
| InChI | InChI=1S/C19H18N4S/c1-12-19(24-13(2)23-12)14-6-8-16(18(21)11-14)17(20)9-7-15-5-3-4-10-22-15/h3-11,20H,21H2,1-2H3/b9-7+,20-17+ |
| InChIKey | MORARLDNALFJLR-GHSISJBBSA-N |
| XLogP | 4.49 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline?
The IUPAC name of 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline (CID 166735767) is 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline.
What is the SMILES notation for 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline?
The canonical SMILES for 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline is [H]/N=C(\C=C\c1ccccn1)c1ccc(-c2sc(C)nc2C)cc1N.
What is the InChIKey of 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline?
The InChIKey is MORARLDNALFJLR-GHSISJBBSA-N. The full InChI is InChI=1S/C19H18N4S/c1-12-19(24-13(2)23-12)14-6-8-16(18(21)11-14)17(20)9-7-15-5-3-4-10-22-15/h3-11,20H,21H2,1-2H3/b9-7+,20-17+.
What are the key properties of 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline?
5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline has a molecular weight of 334.45 g/mol, XLogP of 4.49, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethyl-1,3-thiazol-5-yl)-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline is sourced from PubChem (CID 166735767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).