C7H14N2 — CID 166735939
3,4,6-trimethyl-2,6-dihydro-1H-pyrimidine (PubChem CID 166735939) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 3,4,6-trimethyl-2,6-dihydro-1H-pyrimidine.
| Compound Name | 3,4,6-trimethyl-2,6-dihydro-1H-pyrimidine |
|---|---|
| PubChem CID | 166735939 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 3,4,6-trimethyl-2,6-dihydro-1H-pyrimidine |
| SMILES | CC1=CC(C)NCN1C |
| InChI | InChI=1S/C7H14N2/c1-6-4-7(2)9(3)5-8-6/h4,6,8H,5H2,1-3H3 |
| InChIKey | MNMZTFOGRHQRTN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |