C17H21N7 — CID 166736529
N-[(Z)-2-[4-[1-[(2S)-butan-2-yl]pyrazol-4-yl]pyrazolo[1,5-a]pyrazin-6-yl]prop-2-enylideneamino]methanamine (PubChem CID 166736529) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(Z)-2-[4-[1-[(2S)-butan-2-yl]pyrazol-4-yl]pyrazolo[1,5-a]pyrazin-6-yl]prop-2-enylideneamino]methanamine.
| Compound Name | N-[(Z)-2-[4-[1-[(2S)-butan-2-yl]pyrazol-4-yl]pyrazolo[1,5-a]pyrazin-6-yl]prop-2-enylideneamino]methanamine |
|---|---|
| PubChem CID | 166736529 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[(Z)-2-[4-[1-[(2S)-butan-2-yl]pyrazol-4-yl]pyrazolo[1,5-a]pyrazin-6-yl]prop-2-enylideneamino]methanamine |
| SMILES | C=C(/C=N\NC)c1cn2nccc2c(-c2cnn([C@@H](C)CC)c2)n1 |
| InChI | InChI=1S/C17H21N7/c1-5-13(3)23-10-14(9-21-23)17-16-6-7-20-24(16)11-15(22-17)12(2)8-19-18-4/h6-11,13,18H,2,5H2,1,3-4H3/b19-8-/t13-/m0/s1 |
| InChIKey | DMRIAVBDAXHTBA-YPPWBJDHSA-N |
| XLogP | 2.78 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|