C17H24N2O3 — CID 166736597
6-formyl-N,2-dimethyl-N-[1-(methylamino)-1-oxohex-5-en-2-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 166736597) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 6-formyl-N,2-dimethyl-N-[1-(methylamino)-1-oxohex-5-en-2-yl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 6-formyl-N,2-dimethyl-N-[1-(methylamino)-1-oxohex-5-en-2-yl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 166736597 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 6-formyl-N,2-dimethyl-N-[1-(methylamino)-1-oxohex-5-en-2-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | C=CCCC(C(=O)NC)N(C)C(=O)C1=C(C)CCC=C1C=O |
| InChI | InChI=1S/C17H24N2O3/c1-5-6-10-14(16(21)18-3)19(4)17(22)15-12(2)8-7-9-13(15)11-20/h5,9,11,14H,1,6-8,10H2,2-4H3,(H,18,21) |
| InChIKey | XRGUBQNDXJYTMC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|