About (4S)-4-ethenyl-6-methylheptane-1,2-diimine
(4S)-4-ethenyl-6-methylheptane-1,2-diimine (PubChem CID 166736814) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (4S)-4-ethenyl-6-methylheptane-1,2-diimine.
Molecular Properties
| Compound Name | (4S)-4-ethenyl-6-methylheptane-1,2-diimine |
| PubChem CID | 166736814 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (4S)-4-ethenyl-6-methylheptane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])C[C@@H](C=C)CC(C)C |
| InChI | InChI=1S/C10H18N2/c1-4-9(5-8(2)3)6-10(12)7-11/h4,7-9,11-12H,1,5-6H2,2-3H3/b11-7+,12-10-/t9-/m0/s1 |
| InChIKey | CTVRHYGBXBMDDA-IRENGLFDSA-N |
| XLogP | 2.89 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-ethenyl-6-methylheptane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-ethenyl-6-methylheptane-1,2-diimine?
The IUPAC name of (4S)-4-ethenyl-6-methylheptane-1,2-diimine (CID 166736814) is (4S)-4-ethenyl-6-methylheptane-1,2-diimine.
What is the SMILES notation for (4S)-4-ethenyl-6-methylheptane-1,2-diimine?
The canonical SMILES for (4S)-4-ethenyl-6-methylheptane-1,2-diimine is [H]/N=C(\C=N\[H])C[C@@H](C=C)CC(C)C.
What is the InChIKey of (4S)-4-ethenyl-6-methylheptane-1,2-diimine?
The InChIKey is CTVRHYGBXBMDDA-IRENGLFDSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-9(5-8(2)3)6-10(12)7-11/h4,7-9,11-12H,1,5-6H2,2-3H3/b11-7+,12-10-/t9-/m0/s1.
What are the key properties of (4S)-4-ethenyl-6-methylheptane-1,2-diimine?
(4S)-4-ethenyl-6-methylheptane-1,2-diimine has a molecular weight of 166.27 g/mol, XLogP of 2.89, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-ethenyl-6-methylheptane-1,2-diimine is sourced from PubChem (CID 166736814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).