C34H30FN7O4 — CID 166737165
N-benzyl-2-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 166737165) has the molecular formula C34H30FN7O4 and a molecular weight of 619.66 g/mol. Its IUPAC name is N-benzyl-2-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-2-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 166737165 |
| Molecular Formula | C34H30FN7O4 |
| Molecular Weight | 619.66 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | N-benzyl-2-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | O=C1CN2C(=O)CN(Cc3cc(-c4ccc(F)cc4)no3)N(C(=O)NCc3ccccc3)C2CN1Cc1cccc2ncccc12 |
| InChI | InChI=1S/C34H30FN7O4/c35-26-13-11-24(12-14-26)30-16-27(46-38-30)19-40-21-33(44)41-22-32(43)39(18-25-8-4-10-29-28(25)9-5-15-36-29)20-31(41)42(40)34(45)37-17-23-6-2-1-3-7-23/h1-16,31H,17-22H2,(H,37,45) |
| InChIKey | DARJIEWIMDXLSB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |