About N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide
N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide (PubChem CID 16673736) has the molecular formula C21H22ClFN2O3
and a molecular weight of 404.87 g/mol. Its IUPAC name is N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide |
| PubChem CID | 16673736 |
| Molecular Formula | C21H22ClFN2O3 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1(c2ccccc2F)CCN(Cc2cc(Cl)c3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H22ClFN2O3/c1-14(26)24-21(16-4-2-3-5-18(16)23)6-8-25(9-7-21)12-15-10-17(22)20-19(11-15)27-13-28-20/h2-5,10-11H,6-9,12-13H2,1H3,(H,24,26) |
| InChIKey | BEPHGYOCDBCSPW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide?
The IUPAC name of N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide (CID 16673736) is N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide.
What is the SMILES notation for N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide?
The canonical SMILES for N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide is CC(=O)NC1(c2ccccc2F)CCN(Cc2cc(Cl)c3c(c2)OCO3)CC1.
What is the InChIKey of N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide?
The InChIKey is BEPHGYOCDBCSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClFN2O3/c1-14(26)24-21(16-4-2-3-5-18(16)23)6-8-25(9-7-21)12-15-10-17(22)20-19(11-15)27-13-28-20/h2-5,10-11H,6-9,12-13H2,1H3,(H,24,26).
What are the key properties of N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide?
N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide has a molecular weight of 404.87 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-4-(2-fluorophenyl)piperidin-4-yl]acetamide is sourced from PubChem (CID 16673736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).