C18H23N5O2S — CID 16673853
N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 16673853) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 16673853 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1ccc2nc(C)cc(NCCNS(=O)(=O)c3cn(C)nc3C)c2c1 |
| InChI | InChI=1S/C18H23N5O2S/c1-12-5-6-16-15(9-12)17(10-13(2)21-16)19-7-8-20-26(24,25)18-11-23(4)22-14(18)3/h5-6,9-11,20H,7-8H2,1-4H3,(H,19,21) |
| InChIKey | PTJBZWCYXJUKEN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|