C12H20S — CID 166738781
(3Z)-2,6,6-trimethyl-5-methylidene-4-methylsulfanylhepta-1,3-diene (PubChem CID 166738781) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is (3Z)-2,6,6-trimethyl-5-methylidene-4-methylsulfanylhepta-1,3-diene.
| Compound Name | (3Z)-2,6,6-trimethyl-5-methylidene-4-methylsulfanylhepta-1,3-diene |
|---|---|
| PubChem CID | 166738781 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (3Z)-2,6,6-trimethyl-5-methylidene-4-methylsulfanylhepta-1,3-diene |
| SMILES | C=C(C)/C=C(\SC)C(=C)C(C)(C)C |
| InChI | InChI=1S/C12H20S/c1-9(2)8-11(13-7)10(3)12(4,5)6/h8H,1,3H2,2,4-7H3/b11-8- |
| InChIKey | GGKOFDURPIPUTD-FLIBITNWSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|