About 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine
5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine (PubChem CID 166743201) has the molecular formula C23H22BrIN2
and a molecular weight of 533.25 g/mol. Its IUPAC name is 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine.
Molecular Properties
| Compound Name | 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine |
| PubChem CID | 166743201 |
| Molecular Formula | C23H22BrIN2 |
| Molecular Weight | 533.25 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine |
| SMILES | CCc1ccc(/C=C/c2cc(Br)cnc2-c2cnc(I)c(C)c2)cc1CC |
| InChI | InChI=1S/C23H22BrIN2/c1-4-17-8-6-16(11-18(17)5-2)7-9-19-12-21(24)14-26-22(19)20-10-15(3)23(25)27-13-20/h6-14H,4-5H2,1-3H3/b9-7+ |
| InChIKey | XCTKFEDKLVLJOW-VQHVLOKHSA-N |
| XLogP | 7.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.25 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine?
The IUPAC name of 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine (CID 166743201) is 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine.
What is the SMILES notation for 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine?
The canonical SMILES for 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine is CCc1ccc(/C=C/c2cc(Br)cnc2-c2cnc(I)c(C)c2)cc1CC.
What is the InChIKey of 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine?
The InChIKey is XCTKFEDKLVLJOW-VQHVLOKHSA-N. The full InChI is InChI=1S/C23H22BrIN2/c1-4-17-8-6-16(11-18(17)5-2)7-9-19-12-21(24)14-26-22(19)20-10-15(3)23(25)27-13-20/h6-14H,4-5H2,1-3H3/b9-7+.
What are the key properties of 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine?
5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine has a molecular weight of 533.25 g/mol, XLogP of 7.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-[(E)-2-(3,4-diethylphenyl)ethenyl]-2-(6-iodo-5-methyl-3-pyridinyl)pyridine is sourced from PubChem (CID 166743201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).