C23H27N7O5 — CID 166744653
methyl 2-[[(Z)-2-amino-3-[1-formyl-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]prop-1-enyl]amino]acetate (PubChem CID 166744653) has the molecular formula C23H27N7O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is methyl 2-[[(Z)-2-amino-3-[1-formyl-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]prop-1-enyl]amino]acetate.
| Compound Name | methyl 2-[[(Z)-2-amino-3-[1-formyl-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]prop-1-enyl]amino]acetate |
|---|---|
| PubChem CID | 166744653 |
| Molecular Formula | C23H27N7O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | methyl 2-[[(Z)-2-amino-3-[1-formyl-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]prop-1-enyl]amino]acetate |
| SMILES | COC(=O)CN/C=C(\N)CN1CC(=O)N2CC(=O)N(Cc3cccc4ncccc34)CC2N1C=O |
| InChI | InChI=1S/C23H27N7O5/c1-35-23(34)9-25-8-17(24)11-28-13-22(33)29-14-21(32)27(12-20(29)30(28)15-31)10-16-4-2-6-19-18(16)5-3-7-26-19/h2-8,15,20,25H,9-14,24H2,1H3/b17-8- |
| InChIKey | WBVMQTLIUNUEAC-IUXPMGMMSA-N |
| XLogP | -1.02 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|