C21H28FN3O2S — CID 16674505
N-[1-(4-fluorophenyl)cyclopentyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 16674505) has the molecular formula C21H28FN3O2S and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)cyclopentyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[1-(4-fluorophenyl)cyclopentyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 16674505 |
| Molecular Formula | C21H28FN3O2S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[1-(4-fluorophenyl)cyclopentyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NC1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C21H28FN3O2S/c22-15-9-7-14(8-10-15)21(11-3-4-12-21)25-18(26)6-2-1-5-17-19-16(13-28-17)23-20(27)24-19/h7-10,16-17,19H,1-6,11-13H2,(H,25,26)(H2,23,24,27) |
| InChIKey | HQOVSXMDUKMUBF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|