C15H18ClN5O4 — CID 166745635
5-[4-chloro-3-nitro-5-(1-piperidin-4-ylethylamino)phenyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 166745635) has the molecular formula C15H18ClN5O4 and a molecular weight of 367.79 g/mol. Its IUPAC name is 5-[4-chloro-3-nitro-5-(1-piperidin-4-ylethylamino)phenyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[4-chloro-3-nitro-5-(1-piperidin-4-ylethylamino)phenyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 166745635 |
| Molecular Formula | C15H18ClN5O4 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 5-[4-chloro-3-nitro-5-(1-piperidin-4-ylethylamino)phenyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | CC(Nc1cc(-c2n[nH]c(=O)o2)cc([N+](=O)[O-])c1Cl)C1CCNCC1 |
| InChI | InChI=1S/C15H18ClN5O4/c1-8(9-2-4-17-5-3-9)18-11-6-10(14-19-20-15(22)25-14)7-12(13(11)16)21(23)24/h6-9,17-18H,2-5H2,1H3,(H,20,22) |
| InChIKey | RVONXVGNIPTPDK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|