C16H19BrN4 — CID 166747106
3-[6-bromo-5-[(3-ethylpyrazol-1-yl)methyl]-2-pyridinyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 166747106) has the molecular formula C16H19BrN4 and a molecular weight of 347.26 g/mol. Its IUPAC name is 3-[6-bromo-5-[(3-ethylpyrazol-1-yl)methyl]-2-pyridinyl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-[6-bromo-5-[(3-ethylpyrazol-1-yl)methyl]-2-pyridinyl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 166747106 |
| Molecular Formula | C16H19BrN4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[6-bromo-5-[(3-ethylpyrazol-1-yl)methyl]-2-pyridinyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | CCc1ccn(Cc2ccc(N3CC4CC4C3)nc2Br)n1 |
| InChI | InChI=1S/C16H19BrN4/c1-2-14-5-6-21(19-14)10-11-3-4-15(18-16(11)17)20-8-12-7-13(12)9-20/h3-6,12-13H,2,7-10H2,1H3 |
| InChIKey | ISWZHNOIXNILBL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|