C22H25N5O4S — CID 166748282
N-[5-[(2,6-dimethylphenyl)sulfamoyl]-6-methoxy-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 166748282) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[5-[(2,6-dimethylphenyl)sulfamoyl]-6-methoxy-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[5-[(2,6-dimethylphenyl)sulfamoyl]-6-methoxy-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166748282 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[5-[(2,6-dimethylphenyl)sulfamoyl]-6-methoxy-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1ncc(NC(=O)c2cn3c(n2)CCCC3)cc1S(=O)(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C22H25N5O4S/c1-14-7-6-8-15(2)20(14)26-32(29,30)18-11-16(12-23-22(18)31-3)24-21(28)17-13-27-10-5-4-9-19(27)25-17/h6-8,11-13,26H,4-5,9-10H2,1-3H3,(H,24,28) |
| InChIKey | XKKYQBLBOQBSKF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |