About N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide
N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 166748377) has the molecular formula C18H16BrN3O5S
and a molecular weight of 466.31 g/mol. Its IUPAC name is N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide |
| PubChem CID | 166748377 |
| Molecular Formula | C18H16BrN3O5S |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCO)c(S(=O)(=O)Nc2ccc(Br)cc2)c1)c1ncco1 |
| InChI | InChI=1S/C18H16BrN3O5S/c19-13-2-5-14(6-3-13)22-28(25,26)16-11-15(4-1-12(16)7-9-23)21-17(24)18-20-8-10-27-18/h1-6,8,10-11,22-23H,7,9H2,(H,21,24) |
| InChIKey | AEOUGSZJZLDLBW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide?
The IUPAC name of N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide (CID 166748377) is N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide.
What is the SMILES notation for N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide?
The canonical SMILES for N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide is O=C(Nc1ccc(CCO)c(S(=O)(=O)Nc2ccc(Br)cc2)c1)c1ncco1.
What is the InChIKey of N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide?
The InChIKey is AEOUGSZJZLDLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrN3O5S/c19-13-2-5-14(6-3-13)22-28(25,26)16-11-15(4-1-12(16)7-9-23)21-17(24)18-20-8-10-27-18/h1-6,8,10-11,22-23H,7,9H2,(H,21,24).
What are the key properties of N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide?
N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide has a molecular weight of 466.31 g/mol, XLogP of 3.03, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(4-bromophenyl)sulfamoyl]-4-(2-hydroxyethyl)phenyl]-1,3-oxazole-2-carboxamide is sourced from PubChem (CID 166748377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).