About (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal
(5Z,15Z)-10-hydroxyhenicosa-5,15-dienal (PubChem CID 166748855) has the molecular formula C21H38O2
and a molecular weight of 322.53 g/mol. Its IUPAC name is (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal.
Molecular Properties
| Compound Name | (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal |
| PubChem CID | 166748855 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal |
| SMILES | CCCCC/C=C\CCCCC(O)CCC/C=C\CCCC=O |
| InChI | InChI=1S/C21H38O2/c1-2-3-4-5-6-7-9-12-15-18-21(23)19-16-13-10-8-11-14-17-20-22/h6-8,10,20-21,23H,2-5,9,11-19H2,1H3/b7-6-,10-8- |
| InChIKey | VDWBIABECKBFLG-INZNQPOWSA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal?
The IUPAC name of (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal (CID 166748855) is (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal.
What is the SMILES notation for (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal?
The canonical SMILES for (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal is CCCCC/C=C\CCCCC(O)CCC/C=C\CCCC=O.
What is the InChIKey of (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal?
The InChIKey is VDWBIABECKBFLG-INZNQPOWSA-N. The full InChI is InChI=1S/C21H38O2/c1-2-3-4-5-6-7-9-12-15-18-21(23)19-16-13-10-8-11-14-17-20-22/h6-8,10,20-21,23H,2-5,9,11-19H2,1H3/b7-6-,10-8-.
What are the key properties of (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal?
(5Z,15Z)-10-hydroxyhenicosa-5,15-dienal has a molecular weight of 322.53 g/mol, XLogP of 6.14, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,15Z)-10-hydroxyhenicosa-5,15-dienal is sourced from PubChem (CID 166748855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).