C30H27ClF2N2O6 — CID 166749249
[(2S)-5-chloro-4-[6-cyano-2-fluoro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]methylcarbamic acid (PubChem CID 166749249) has the molecular formula C30H27ClF2N2O6 and a molecular weight of 585.00 g/mol. Its IUPAC name is [(2S)-5-chloro-4-[6-cyano-2-fluoro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]methylcarbamic acid.
| Compound Name | [(2S)-5-chloro-4-[6-cyano-2-fluoro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 166749249 |
| Molecular Formula | C30H27ClF2N2O6 |
| Molecular Weight | 585.00 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [(2S)-5-chloro-4-[6-cyano-2-fluoro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]methylcarbamic acid |
| SMILES | N#Cc1ccc(OCCOC2CCCCO2)c(F)c1-c1c(Cl)c(F)cc2c1C[C@@](CNC(=O)O)(c1ccccc1)O2 |
| InChI | InChI=1S/C30H27ClF2N2O6/c31-27-21(32)14-23-20(15-30(41-23,17-35-29(36)37)19-6-2-1-3-7-19)26(27)25-18(16-34)9-10-22(28(25)33)38-12-13-40-24-8-4-5-11-39-24/h1-3,6-7,9-10,14,24,35H,4-5,8,11-13,15,17H2,(H,36,37)/t24?,30-/m1/s1 |
| InChIKey | UTTJIJSTYGZEDY-BXFARTRRSA-N |
| XLogP | 6.18 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.00 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|