C55H53N — CID 166751425
N-(8a,9,9-trimethyl-4bH-fluoren-2-yl)-1-methyl-N-[4-(4-methylphenyl)cyclohexa-1,5-dien-1-yl]spiro[1,2,4a,9a-tetrahydrofluorene-9,9'-4b,8a-dihydrofluorene]-2'-amine (PubChem CID 166751425) has the molecular formula C55H53N and a molecular weight of 728.04 g/mol. Its IUPAC name is N-(8a,9,9-trimethyl-4bH-fluoren-2-yl)-1-methyl-N-[4-(4-methylphenyl)cyclohexa-1,5-dien-1-yl]spiro[1,2,4a,9a-tetrahydrofluorene-9,9'-4b,8a-dihydrofluorene]-2'-amine.
| Compound Name | N-(8a,9,9-trimethyl-4bH-fluoren-2-yl)-1-methyl-N-[4-(4-methylphenyl)cyclohexa-1,5-dien-1-yl]spiro[1,2,4a,9a-tetrahydrofluorene-9,9'-4b,8a-dihydrofluorene]-2'-amine |
|---|---|
| PubChem CID | 166751425 |
| Molecular Formula | C55H53N |
| Molecular Weight | 728.04 g/mol |
| Exact Mass | 727.42 |
| IUPAC Name | N-(8a,9,9-trimethyl-4bH-fluoren-2-yl)-1-methyl-N-[4-(4-methylphenyl)cyclohexa-1,5-dien-1-yl]spiro[1,2,4a,9a-tetrahydrofluorene-9,9'-4b,8a-dihydrofluorene]-2'-amine |
| SMILES | Cc1ccc(C2C=CC(N(c3ccc4c(c3)C3(c5ccccc5C5C=CCC(C)C53)C3C=CC=CC43)c3ccc4c(c3)C(C)(C)C3(C)C=CC=CC43)=CC2)cc1 |
| InChI | InChI=1S/C55H53N/c1-35-20-22-37(23-21-35)38-24-26-39(27-25-38)56(40-29-31-46-47-17-10-11-32-54(47,5)53(3,4)50(46)33-40)41-28-30-44-42-14-6-8-18-48(42)55(51(44)34-41)49-19-9-7-15-43(49)45-16-12-13-36(2)52(45)55/h6-12,14-24,26-34,36,38,42,45,47-48,52H,13,25H2,1-5H3 |
| InChIKey | OMSACECBFMYKAV-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.04 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|