C13H19NO — CID 166751497
(2E,4Z)-6-(2,2-dimethyl-3H-furan-5-yl)hepta-2,4,6-trien-3-amine (PubChem CID 166751497) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (2E,4Z)-6-(2,2-dimethyl-3H-furan-5-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-(2,2-dimethyl-3H-furan-5-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 166751497 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2E,4Z)-6-(2,2-dimethyl-3H-furan-5-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/C)C1=CCC(C)(C)O1 |
| InChI | InChI=1S/C13H19NO/c1-5-11(14)7-6-10(2)12-8-9-13(3,4)15-12/h5-8H,2,9,14H2,1,3-4H3/b7-6-,11-5+ |
| InChIKey | ZWFGDFXZESXGMR-TUKAJDRUSA-N |
| XLogP | 3.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|