C21H25NO2 — CID 166751595
2-acetyl-5-[5-[(3R)-3-ethylpyrrolidin-1-yl]cyclohepta-1,4,6-trien-1-yl]cyclohexa-2,5-dien-1-one (PubChem CID 166751595) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-acetyl-5-[5-[(3R)-3-ethylpyrrolidin-1-yl]cyclohepta-1,4,6-trien-1-yl]cyclohexa-2,5-dien-1-one.
| Compound Name | 2-acetyl-5-[5-[(3R)-3-ethylpyrrolidin-1-yl]cyclohepta-1,4,6-trien-1-yl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 166751595 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-acetyl-5-[5-[(3R)-3-ethylpyrrolidin-1-yl]cyclohepta-1,4,6-trien-1-yl]cyclohexa-2,5-dien-1-one |
| SMILES | CC[C@@H]1CCN(C2=CCC=C(C3=CC(=O)C(C(C)=O)=CC3)C=C2)C1 |
| InChI | InChI=1S/C21H25NO2/c1-3-16-11-12-22(14-16)19-6-4-5-17(7-9-19)18-8-10-20(15(2)23)21(24)13-18/h5-7,9-10,13,16H,3-4,8,11-12,14H2,1-2H3/t16-/m1/s1 |
| InChIKey | BUIRHNCQMCXTBT-MRXNPFEDSA-N |
| XLogP | 3.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|