C28H38F3N3O5S — CID 166751738
propyl 4-[(3E,5E)-5-[4-[4-(trifluoromethylsulfonyl)anilino]cyclohexyl]oxyhepta-1,3,5-trien-3-yl]piperazine-1-carboxylate (PubChem CID 166751738) has the molecular formula C28H38F3N3O5S and a molecular weight of 585.69 g/mol. Its IUPAC name is propyl 4-[(3E,5E)-5-[4-[4-(trifluoromethylsulfonyl)anilino]cyclohexyl]oxyhepta-1,3,5-trien-3-yl]piperazine-1-carboxylate.
| Compound Name | propyl 4-[(3E,5E)-5-[4-[4-(trifluoromethylsulfonyl)anilino]cyclohexyl]oxyhepta-1,3,5-trien-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166751738 |
| Molecular Formula | C28H38F3N3O5S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | propyl 4-[(3E,5E)-5-[4-[4-(trifluoromethylsulfonyl)anilino]cyclohexyl]oxyhepta-1,3,5-trien-3-yl]piperazine-1-carboxylate |
| SMILES | C=C/C(=C\C(=C/C)OC1CCC(Nc2ccc(S(=O)(=O)C(F)(F)F)cc2)CC1)N1CCN(C(=O)OCCC)CC1 |
| InChI | InChI=1S/C28H38F3N3O5S/c1-4-19-38-27(35)34-17-15-33(16-18-34)23(5-2)20-24(6-3)39-25-11-7-21(8-12-25)32-22-9-13-26(14-10-22)40(36,37)28(29,30)31/h5-6,9-10,13-14,20-21,25,32H,2,4,7-8,11-12,15-19H2,1,3H3/b23-20+,24-6+ |
| InChIKey | YEXCQMBPXICMLQ-RJFKDZDOSA-N |
| XLogP | 5.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|