C23H33N5O2 — CID 166752521
(2R,4R)-N-[(2S)-1-[(6-amino-2-methyl-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine-2-carboxamide (PubChem CID 166752521) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (2R,4R)-N-[(2S)-1-[(6-amino-2-methyl-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine-2-carboxamide.
| Compound Name | (2R,4R)-N-[(2S)-1-[(6-amino-2-methyl-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 166752521 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | (2R,4R)-N-[(2S)-1-[(6-amino-2-methyl-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine-2-carboxamide |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1CCN[C@@H](C(=O)N[C@@H](C)C(=O)NCc2ccc(N)nc2C)C1 |
| InChI | InChI=1S/C23H33N5O2/c1-5-6-7-8-15(2)18-11-12-25-20(13-18)23(30)28-17(4)22(29)26-14-19-9-10-21(24)27-16(19)3/h5-10,17-18,20,25H,2,11-14H2,1,3-4H3,(H2,24,27)(H,26,29)(H,28,30)/b6-5-,8-7-/t17-,18+,20+/m0/s1 |
| InChIKey | JHSMGMHFHBLFKH-GPRCUMEWSA-N |
| XLogP | 2.15 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|