C29H26FN5O2 — CID 166752684
(5aR,6R,9aS)-3-(4-fluorophenyl)-7-hydroxy-6,9a-dimethyl-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-5,5a,6,7-tetrahydro-4H-benzo[g]indazole-8-carbonitrile (PubChem CID 166752684) has the molecular formula C29H26FN5O2 and a molecular weight of 495.56 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(4-fluorophenyl)-7-hydroxy-6,9a-dimethyl-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-5,5a,6,7-tetrahydro-4H-benzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-3-(4-fluorophenyl)-7-hydroxy-6,9a-dimethyl-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-5,5a,6,7-tetrahydro-4H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 166752684 |
| Molecular Formula | C29H26FN5O2 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (5aR,6R,9aS)-3-(4-fluorophenyl)-7-hydroxy-6,9a-dimethyl-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-5,5a,6,7-tetrahydro-4H-benzo[g]indazole-8-carbonitrile |
| SMILES | Cc1noc(-c2ccc(-n3nc(-c4ccc(F)cc4)c4c3[C@]3(C)C=C(C#N)C(O)[C@H](C)[C@H]3CC4)cc2)n1 |
| InChI | InChI=1S/C29H26FN5O2/c1-16-24-13-12-23-25(18-4-8-21(30)9-5-18)33-35(27(23)29(24,3)14-20(15-31)26(16)36)22-10-6-19(7-11-22)28-32-17(2)34-37-28/h4-11,14,16,24,26,36H,12-13H2,1-3H3/t16-,24-,26?,29-/m1/s1 |
| InChIKey | DQFRGGJQSMVOTK-RKKKVUPXSA-N |
| XLogP | 5.32 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |