C25H30F3N7O2 — CID 166753360
N-[2-[4-[(3S)-3-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]cyclopentanecarboxamide (PubChem CID 166753360) has the molecular formula C25H30F3N7O2 and a molecular weight of 517.56 g/mol. Its IUPAC name is N-[2-[4-[(3S)-3-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]cyclopentanecarboxamide.
| Compound Name | N-[2-[4-[(3S)-3-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 166753360 |
| Molecular Formula | C25H30F3N7O2 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[2-[4-[(3S)-3-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]cyclopentanecarboxamide |
| SMILES | C=C(/C=C(F)\C=C(/C)F)[C@@H]1CC=NN1C(=O)N1CCN(c2ncc(F)c(NC(=O)C3CCCC3)n2)CC1 |
| InChI | InChI=1S/C25H30F3N7O2/c1-16(13-19(27)14-17(2)26)21-7-8-30-35(21)25(37)34-11-9-33(10-12-34)24-29-15-20(28)22(32-24)31-23(36)18-5-3-4-6-18/h8,13-15,18,21H,1,3-7,9-12H2,2H3,(H,29,31,32,36)/b17-14+,19-13+/t21-/m0/s1 |
| InChIKey | FKLKNDFDDUYVBG-PYBITGLZSA-N |
| XLogP | 4.33 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|