C18H26O7 — CID 166753571
ethyl (3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate (PubChem CID 166753571) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is ethyl (3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate.
| Compound Name | ethyl (3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate |
|---|---|
| PubChem CID | 166753571 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | ethyl (3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)O[C@]23CC=CC[C@@H]2[C@H](OOC(C)(C)C)C[C@]13O |
| InChI | InChI=1S/C18H26O7/c1-5-22-14(19)13-15(20)23-18-9-7-6-8-11(18)12(10-17(13,18)21)24-25-16(2,3)4/h6-7,11-13,21H,5,8-10H2,1-4H3/t11-,12-,13?,17+,18-/m1/s1 |
| InChIKey | ZWKIRAXVDKECER-ALUFBJRVSA-N |
| XLogP | 1.68 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|