C18H26O2 — CID 166753579
(2S,3aS,5R,5aR,9aR)-5-but-3-enyl-2-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-3a-ol (PubChem CID 166753579) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (2S,3aS,5R,5aR,9aR)-5-but-3-enyl-2-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-3a-ol.
| Compound Name | (2S,3aS,5R,5aR,9aR)-5-but-3-enyl-2-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-3a-ol |
|---|---|
| PubChem CID | 166753579 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (2S,3aS,5R,5aR,9aR)-5-but-3-enyl-2-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-3a-ol |
| SMILES | C=CCC[C@@H]1C[C@]2(O)C[C@H](CC=C)O[C@@]23CC=CC[C@H]13 |
| InChI | InChI=1S/C18H26O2/c1-3-5-9-14-12-17(19)13-15(8-4-2)20-18(17)11-7-6-10-16(14)18/h3-4,6-7,14-16,19H,1-2,5,8-13H2/t14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | ZKQPALQDRWWJTO-MDMSPXHWSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|