C38H24F8N2O2S2 — CID 166754522
2-[2-methoxy-5-[4-[3,3,4,4,5,5,6,6-octafluoro-2-[5-(4-methoxy-3-pyridin-2-ylphenyl)thiophen-3-yl]cyclohexen-1-yl]thiophen-2-yl]phenyl]pyridine (PubChem CID 166754522) has the molecular formula C38H24F8N2O2S2 and a molecular weight of 756.74 g/mol. Its IUPAC name is 2-[2-methoxy-5-[4-[3,3,4,4,5,5,6,6-octafluoro-2-[5-(4-methoxy-3-pyridin-2-ylphenyl)thiophen-3-yl]cyclohexen-1-yl]thiophen-2-yl]phenyl]pyridine.
| Compound Name | 2-[2-methoxy-5-[4-[3,3,4,4,5,5,6,6-octafluoro-2-[5-(4-methoxy-3-pyridin-2-ylphenyl)thiophen-3-yl]cyclohexen-1-yl]thiophen-2-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 166754522 |
| Molecular Formula | C38H24F8N2O2S2 |
| Molecular Weight | 756.74 g/mol |
| Exact Mass | 756.12 |
| IUPAC Name | 2-[2-methoxy-5-[4-[3,3,4,4,5,5,6,6-octafluoro-2-[5-(4-methoxy-3-pyridin-2-ylphenyl)thiophen-3-yl]cyclohexen-1-yl]thiophen-2-yl]phenyl]pyridine |
| SMILES | COc1ccc(-c2cc(C3=C(c4csc(-c5ccc(OC)c(-c6ccccn6)c5)c4)C(F)(F)C(F)(F)C(F)(F)C3(F)F)cs2)cc1-c1ccccn1 |
| InChI | InChI=1S/C38H24F8N2O2S2/c1-49-29-11-9-21(15-25(29)27-7-3-5-13-47-27)31-17-23(19-51-31)33-34(36(41,42)38(45,46)37(43,44)35(33,39)40)24-18-32(52-20-24)22-10-12-30(50-2)26(16-22)28-8-4-6-14-48-28/h3-20H,1-2H3 |
| InChIKey | GJTNHFBNKBKKKY-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.74 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|