C12H22S — CID 166754700
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethanethiol (PubChem CID 166754700) has the molecular formula C12H22S and a molecular weight of 198.37 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethanethiol.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethanethiol |
|---|---|
| PubChem CID | 166754700 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethanethiol |
| SMILES | CC(S)C1CCCC2CCCCC21 |
| InChI | InChI=1S/C12H22S/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h9-13H,2-8H2,1H3 |
| InChIKey | BGQIHLGUFCEPIM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|