C15H20O2 — CID 166754770
(3Z,5Z,7Z,8Z)-5,7-di(ethylidene)undeca-1,3,8,10-tetraene-2,10-diol (PubChem CID 166754770) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3Z,5Z,7Z,8Z)-5,7-di(ethylidene)undeca-1,3,8,10-tetraene-2,10-diol.
| Compound Name | (3Z,5Z,7Z,8Z)-5,7-di(ethylidene)undeca-1,3,8,10-tetraene-2,10-diol |
|---|---|
| PubChem CID | 166754770 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3Z,5Z,7Z,8Z)-5,7-di(ethylidene)undeca-1,3,8,10-tetraene-2,10-diol |
| SMILES | C=C(O)/C=C\C(=C/C)CC(/C=C\C(=C)O)=C/C |
| InChI | InChI=1S/C15H20O2/c1-5-14(9-7-12(3)16)11-15(6-2)10-8-13(4)17/h5-10,16-17H,3-4,11H2,1-2H3/b9-7-,10-8-,14-5+,15-6+ |
| InChIKey | ACOHRYREURIMLO-VYTCKWHNSA-N |
| XLogP | 4.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|