C34H42N4O3S — CID 166755391
1-cyclobutyl-6-[5-[5-oxo-5-(2-sulfanylcyclobutyl)pentyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl]hexane-1,6-dione (PubChem CID 166755391) has the molecular formula C34H42N4O3S and a molecular weight of 586.80 g/mol. Its IUPAC name is 1-cyclobutyl-6-[5-[5-oxo-5-(2-sulfanylcyclobutyl)pentyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl]hexane-1,6-dione.
| Compound Name | 1-cyclobutyl-6-[5-[5-oxo-5-(2-sulfanylcyclobutyl)pentyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl]hexane-1,6-dione |
|---|---|
| PubChem CID | 166755391 |
| Molecular Formula | C34H42N4O3S |
| Molecular Weight | 586.80 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 1-cyclobutyl-6-[5-[5-oxo-5-(2-sulfanylcyclobutyl)pentyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),7,9,11,15,17-heptaen-13-yl]hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1Cc2ccccc2C2=C(c3ccccc31)N(CCCCC(=O)C1CCC1S)NN2)C1CCC1 |
| InChI | InChI=1S/C34H42N4O3S/c39-29(23-11-9-12-23)16-5-6-18-32(41)37-22-24-10-1-2-13-25(24)33-34(26-14-3-4-15-28(26)37)38(36-35-33)21-8-7-17-30(40)27-19-20-31(27)42/h1-4,10,13-15,23,27,31,35-36,42H,5-9,11-12,16-22H2 |
| InChIKey | SBVXKCXAALRYNW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.80 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|