C16H31NS3 — CID 166755666
1-(1-amino-2,4,4-trimethyl-5-prop-2-enylsulfanylpentan-2-yl)sulfanyl-3-methylbut-3-ene-2-thiol (PubChem CID 166755666) has the molecular formula C16H31NS3 and a molecular weight of 333.63 g/mol. Its IUPAC name is 1-(1-amino-2,4,4-trimethyl-5-prop-2-enylsulfanylpentan-2-yl)sulfanyl-3-methylbut-3-ene-2-thiol.
| Compound Name | 1-(1-amino-2,4,4-trimethyl-5-prop-2-enylsulfanylpentan-2-yl)sulfanyl-3-methylbut-3-ene-2-thiol |
|---|---|
| PubChem CID | 166755666 |
| Molecular Formula | C16H31NS3 |
| Molecular Weight | 333.63 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-(1-amino-2,4,4-trimethyl-5-prop-2-enylsulfanylpentan-2-yl)sulfanyl-3-methylbut-3-ene-2-thiol |
| SMILES | C=CCSCC(C)(C)CC(C)(CN)SCC(S)C(=C)C |
| InChI | InChI=1S/C16H31NS3/c1-7-8-19-12-15(4,5)10-16(6,11-17)20-9-14(18)13(2)3/h7,14,18H,1-2,8-12,17H2,3-6H3 |
| InChIKey | DHCPRKVCWYZSLW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|