C28H29F3N2O2S — CID 166755880
3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-sulfonamide (PubChem CID 166755880) has the molecular formula C28H29F3N2O2S and a molecular weight of 514.61 g/mol. Its IUPAC name is 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-sulfonamide.
| Compound Name | 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 166755880 |
| Molecular Formula | C28H29F3N2O2S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(C(F)(F)F)cc1)N1CCCC(C2c3ccccc3CCc3ccccc32)C1 |
| InChI | InChI=1S/C28H29F3N2O2S/c29-28(30,31)24-15-11-20(12-16-24)18-32-36(34,35)33-17-5-8-23(19-33)27-25-9-3-1-6-21(25)13-14-22-7-2-4-10-26(22)27/h1-4,6-7,9-12,15-16,23,27,32H,5,8,13-14,17-19H2 |
| InChIKey | JSICUKUCZMXMFW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |