About 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline
3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline (PubChem CID 166756160) has the molecular formula C10H13ClFN
and a molecular weight of 201.67 g/mol. Its IUPAC name is 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline.
Molecular Properties
| Compound Name | 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline |
| PubChem CID | 166756160 |
| Molecular Formula | C10H13ClFN |
| Molecular Weight | 201.67 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline |
| SMILES | CCc1c(N)c(C)c(C)c(F)c1Cl |
| InChI | InChI=1S/C10H13ClFN/c1-4-7-8(11)9(12)5(2)6(3)10(7)13/h4,13H2,1-3H3 |
| InChIKey | XMBXTYSWLIUYSL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.67 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline?
The IUPAC name of 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline (CID 166756160) is 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline.
What is the SMILES notation for 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline?
The canonical SMILES for 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline is CCc1c(N)c(C)c(C)c(F)c1Cl.
What is the InChIKey of 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline?
The InChIKey is XMBXTYSWLIUYSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClFN/c1-4-7-8(11)9(12)5(2)6(3)10(7)13/h4,13H2,1-3H3.
What are the key properties of 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline?
3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline has a molecular weight of 201.67 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-ethyl-4-fluoro-5,6-dimethylaniline is sourced from PubChem (CID 166756160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).