C20H24BrNO2 — CID 166757201
(1R,5S)-6-[2-(4-bromophenyl)ethynyl]-3-[2-(oxan-2-yloxy)ethyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 166757201) has the molecular formula C20H24BrNO2 and a molecular weight of 390.32 g/mol. Its IUPAC name is (1R,5S)-6-[2-(4-bromophenyl)ethynyl]-3-[2-(oxan-2-yloxy)ethyl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-6-[2-(4-bromophenyl)ethynyl]-3-[2-(oxan-2-yloxy)ethyl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 166757201 |
| Molecular Formula | C20H24BrNO2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (1R,5S)-6-[2-(4-bromophenyl)ethynyl]-3-[2-(oxan-2-yloxy)ethyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | Brc1ccc(C#CC2[C@H]3CN(CCOC4CCCCO4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C20H24BrNO2/c21-16-7-4-15(5-8-16)6-9-17-18-13-22(14-19(17)18)10-12-24-20-3-1-2-11-23-20/h4-5,7-8,17-20H,1-3,10-14H2/t17?,18-,19+,20? |
| InChIKey | YIBUPJVXMSTHPR-REPIYIIUSA-N |
| XLogP | 3.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|