About propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate
propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate (PubChem CID 166757759) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate |
| PubChem CID | 166757759 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc2n1CCC/C(=C/N(C)C)C2=O |
| InChI | InChI=1S/C16H22N2O3/c1-11(2)21-16(20)14-8-7-13-15(19)12(10-17(3)4)6-5-9-18(13)14/h7-8,10-11H,5-6,9H2,1-4H3/b12-10- |
| InChIKey | NFEMZCZDJBZHIU-BENRWUELSA-N |
| XLogP | 2.48 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate?
The IUPAC name of propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate (CID 166757759) is propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate.
What is the SMILES notation for propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate?
The canonical SMILES for propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate is CC(C)OC(=O)c1ccc2n1CCC/C(=C/N(C)C)C2=O.
What is the InChIKey of propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate?
The InChIKey is NFEMZCZDJBZHIU-BENRWUELSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-11(2)21-16(20)14-8-7-13-15(19)12(10-17(3)4)6-5-9-18(13)14/h7-8,10-11H,5-6,9H2,1-4H3/b12-10-.
What are the key properties of propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate?
propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate has a molecular weight of 290.36 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (8Z)-8-(dimethylaminomethylidene)-9-oxo-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxylate is sourced from PubChem (CID 166757759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).