About 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one
2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one (PubChem CID 16675865) has the molecular formula C19H25N3O2S
and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one.
Molecular Properties
| Compound Name | 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one |
| PubChem CID | 16675865 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one |
| SMILES | CC(C)(C)C(=O)N1CCC[C@@H](Cn2nc(-c3cccs3)ccc2=O)C1 |
| InChI | InChI=1S/C19H25N3O2S/c1-19(2,3)18(24)21-10-4-6-14(12-21)13-22-17(23)9-8-15(20-22)16-7-5-11-25-16/h5,7-9,11,14H,4,6,10,12-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | XGHTYOQQERLAFY-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one?
The IUPAC name of 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one (CID 16675865) is 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one.
What is the SMILES notation for 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one?
The canonical SMILES for 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one is CC(C)(C)C(=O)N1CCC[C@@H](Cn2nc(-c3cccs3)ccc2=O)C1.
What is the InChIKey of 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one?
The InChIKey is XGHTYOQQERLAFY-CQSZACIVSA-N. The full InChI is InChI=1S/C19H25N3O2S/c1-19(2,3)18(24)21-10-4-6-14(12-21)13-22-17(23)9-8-15(20-22)16-7-5-11-25-16/h5,7-9,11,14H,4,6,10,12-13H2,1-3H3/t14-/m1/s1.
What are the key properties of 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one?
2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one has a molecular weight of 359.50 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]methyl]-6-thiophen-2-ylpyridazin-3-one is sourced from PubChem (CID 16675865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).