C15H19F5N2O4 — CID 166758997
1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine;2,2,2-trifluoroacetic acid (PubChem CID 166758997) has the molecular formula C15H19F5N2O4 and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166758997 |
| Molecular Formula | C15H19F5N2O4 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine;2,2,2-trifluoroacetic acid |
| SMILES | COCCOc1cc(F)c(N2CCNCC2)c(F)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18F2N2O2.C2HF3O2/c1-18-6-7-19-10-8-11(14)13(12(15)9-10)17-4-2-16-3-5-17;3-2(4,5)1(6)7/h8-9,16H,2-7H2,1H3;(H,6,7) |
| InChIKey | WLMIELFFZMVVIH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|